C11H15NO2S — CID 118445980
1-methyl-6-methylsulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 118445980) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-methyl-6-methylsulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-methyl-6-methylsulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 118445980 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-methyl-6-methylsulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCCc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C11H15NO2S/c1-12-7-3-4-9-8-10(15(2,13)14)5-6-11(9)12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | ULJOIUXFGQOPJP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |