C15H22N2 — CID 82538182
1-methyl-6-piperidin-1-yl-3,4-dihydro-2H-quinoline (PubChem CID 82538182) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-methyl-6-piperidin-1-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-methyl-6-piperidin-1-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 82538182 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-methyl-6-piperidin-1-yl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCCc2cc(N3CCCCC3)ccc21 |
| InChI | InChI=1S/C15H22N2/c1-16-9-5-6-13-12-14(7-8-15(13)16)17-10-3-2-4-11-17/h7-8,12H,2-6,9-11H2,1H3 |
| InChIKey | SZAWWEQFIMSKIE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|