C13H18N2 — CID 168515104
2-methyl-5-pyrrolidin-1-yl-1,3-dihydroisoindole (PubChem CID 168515104) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methyl-5-pyrrolidin-1-yl-1,3-dihydroisoindole.
| Compound Name | 2-methyl-5-pyrrolidin-1-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 168515104 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-methyl-5-pyrrolidin-1-yl-1,3-dihydroisoindole |
| SMILES | CN1Cc2ccc(N3CCCC3)cc2C1 |
| InChI | InChI=1S/C13H18N2/c1-14-9-11-4-5-13(8-12(11)10-14)15-6-2-3-7-15/h4-5,8H,2-3,6-7,9-10H2,1H3 |
| InChIKey | MAZIMBFFJHONMI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|