C13H17NO — CID 11171704
1-(3,4-dihydro-1H-isochromen-6-yl)pyrrolidine (PubChem CID 11171704) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-6-yl)pyrrolidine.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-6-yl)pyrrolidine |
|---|---|
| PubChem CID | 11171704 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-6-yl)pyrrolidine |
| SMILES | c1cc2c(cc1N1CCCC1)CCOC2 |
| InChI | InChI=1S/C13H17NO/c1-2-7-14(6-1)13-4-3-12-10-15-8-5-11(12)9-13/h3-4,9H,1-2,5-8,10H2 |
| InChIKey | ZRUYFDGRIQGJSF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|