C11H14BNO2 — CID 132526332
1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrolidine (PubChem CID 132526332) has the molecular formula C11H14BNO2 and a molecular weight of 203.05 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrolidine.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrolidine |
|---|---|
| PubChem CID | 132526332 |
| Molecular Formula | C11H14BNO2 |
| Molecular Weight | 203.05 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)pyrrolidine |
| SMILES | OB1OCc2ccc(N3CCCC3)cc21 |
| InChI | InChI=1S/C11H14BNO2/c14-12-11-7-10(13-5-1-2-6-13)4-3-9(11)8-15-12/h3-4,7,14H,1-2,5-6,8H2 |
| InChIKey | VHTREXIKEDLOHH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.05 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|