C11H15BO3S — CID 163369772
ethane;S-methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carbothioate (PubChem CID 163369772) has the molecular formula C11H15BO3S and a molecular weight of 238.12 g/mol. Its IUPAC name is ethane;S-methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carbothioate.
| Compound Name | ethane;S-methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carbothioate |
|---|---|
| PubChem CID | 163369772 |
| Molecular Formula | C11H15BO3S |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | ethane;S-methyl 1-hydroxy-3H-2,1-benzoxaborole-6-carbothioate |
| SMILES | CC.CSC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C9H9BO3S.C2H6/c1-14-9(11)6-2-3-7-5-13-10(12)8(7)4-6;1-2/h2-4,12H,5H2,1H3;1-2H3 |
| InChIKey | GTRFSWTXLFOFMF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|