C10H11BO3 — CID 58404079
1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propan-2-one (PubChem CID 58404079) has the molecular formula C10H11BO3 and a molecular weight of 190.01 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propan-2-one.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propan-2-one |
|---|---|
| PubChem CID | 58404079 |
| Molecular Formula | C10H11BO3 |
| Molecular Weight | 190.01 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)propan-2-one |
| SMILES | CC(=O)Cc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C10H11BO3/c1-7(12)4-8-2-3-9-6-14-11(13)10(9)5-8/h2-3,5,13H,4,6H2,1H3 |
| InChIKey | OMLHLAAXXFFPHM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.01 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|