C16H12BNO3 — CID 58404092
4-[2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetyl]benzonitrile (PubChem CID 58404092) has the molecular formula C16H12BNO3 and a molecular weight of 277.09 g/mol. Its IUPAC name is 4-[2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetyl]benzonitrile.
| Compound Name | 4-[2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetyl]benzonitrile |
|---|---|
| PubChem CID | 58404092 |
| Molecular Formula | C16H12BNO3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)acetyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)Cc2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C16H12BNO3/c18-9-11-1-4-13(5-2-11)16(19)8-12-3-6-14-10-21-17(20)15(14)7-12/h1-7,20H,8,10H2 |
| InChIKey | WMOBCHNWDMOERQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|