C8H6BNO2 — CID 11845750
1-hydroxy-3H-2,1-benzoxaborole-5-carbonitrile (PubChem CID 11845750) has the molecular formula C8H6BNO2 and a molecular weight of 158.95 g/mol. Its IUPAC name is 1-hydroxy-3H-2,1-benzoxaborole-5-carbonitrile.
| Compound Name | 1-hydroxy-3H-2,1-benzoxaborole-5-carbonitrile |
|---|---|
| PubChem CID | 11845750 |
| Molecular Formula | C8H6BNO2 |
| Molecular Weight | 158.95 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 1-hydroxy-3H-2,1-benzoxaborole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)COB2O |
| InChI | InChI=1S/C8H6BNO2/c10-4-6-1-2-8-7(3-6)5-12-9(8)11/h1-3,11H,5H2 |
| InChIKey | DGIOKAFHCWJCKM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.95 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|