C10H13BO3 — CID 53319612
3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-ol (PubChem CID 53319612) has the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. Its IUPAC name is 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-ol.
| Compound Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-ol |
|---|---|
| PubChem CID | 53319612 |
| Molecular Formula | C10H13BO3 |
| Molecular Weight | 192.02 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propan-1-ol |
| SMILES | OCCCc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C10H13BO3/c12-6-2-5-8-3-1-4-9-7-14-11(13)10(8)9/h1,3-4,12-13H,2,5-7H2 |
| InChIKey | UQOMTVGUBBKZNF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.02 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|