C8H9BO2 — CID 11845749
1-hydroxy-5-methyl-3H-2,1-benzoxaborole (PubChem CID 11845749) has the molecular formula C8H9BO2 and a molecular weight of 147.97 g/mol. Its IUPAC name is 1-hydroxy-5-methyl-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-5-methyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 11845749 |
| Molecular Formula | C8H9BO2 |
| Molecular Weight | 147.97 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1-hydroxy-5-methyl-3H-2,1-benzoxaborole |
| SMILES | Cc1ccc2c(c1)COB2O |
| InChI | InChI=1S/C8H9BO2/c1-6-2-3-8-7(4-6)5-11-9(8)10/h2-4,10H,5H2,1H3 |
| InChIKey | DPQXHKISEXZJPD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.97 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|