methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate

C11H13BO4 — CID 53317954

IUPACmethyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate
SMILESCOC(=O)CCc1cccc2c1B(O)OC2
InChIInChI=1S/C11H13BO4/c1-15-10(13)6-5-8-3-2-4-9-7-16-12(14)11(8)9/h2-4,14H,5-7H2,1H3
InChIKeyQOJTWYQASIPOQI-UHFFFAOYSA-N
MW220.03 g/mol
LogP0.01
Rot. Bonds3

About methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate

methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate (PubChem CID 53317954) has the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. Its IUPAC name is methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate
PubChem CID53317954
Molecular FormulaC11H13BO4
Molecular Weight220.03 g/mol
Exact Mass220.09
IUPAC Namemethyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate
SMILESCOC(=O)CCc1cccc2c1B(O)OC2
InChIInChI=1S/C11H13BO4/c1-15-10(13)6-5-8-3-2-4-9-7-16-12(14)11(8)9/h2-4,14H,5-7H2,1H3
InChIKeyQOJTWYQASIPOQI-UHFFFAOYSA-N
XLogP0.01
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.03
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate?
The IUPAC name of methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate (CID 53317954) is methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate.
What is the SMILES notation for methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate?
The canonical SMILES for methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate is COC(=O)CCc1cccc2c1B(O)OC2.
What is the InChIKey of methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate?
The InChIKey is QOJTWYQASIPOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BO4/c1-15-10(13)6-5-8-3-2-4-9-7-16-12(14)11(8)9/h2-4,14H,5-7H2,1H3.
What are the key properties of methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate?
methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate has a molecular weight of 220.03 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanoate is sourced from PubChem (CID 53317954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).