C16H15BO3 — CID 57387598
3-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-phenylpropan-1-one (PubChem CID 57387598) has the molecular formula C16H15BO3 and a molecular weight of 266.11 g/mol. Its IUPAC name is 3-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-phenylpropan-1-one.
| Compound Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 57387598 |
| Molecular Formula | C16H15BO3 |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-1-phenylpropan-1-one |
| SMILES | O=C(CCc1ccc2c(c1)B(O)OC2)c1ccccc1 |
| InChI | InChI=1S/C16H15BO3/c18-16(13-4-2-1-3-5-13)9-7-12-6-8-14-11-20-17(19)15(14)10-12/h1-6,8,10,19H,7,9,11H2 |
| InChIKey | BQHMRRBLZFTGOG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|