About 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine
1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine (PubChem CID 159150866) has the molecular formula C16H17BO2
and a molecular weight of 252.12 g/mol. Its IUPAC name is 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine.
Molecular Properties
| Compound Name | 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine |
| PubChem CID | 159150866 |
| Molecular Formula | C16H17BO2 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine |
| SMILES | OB1OCCc2ccc(CCc3ccccc3)cc21 |
| InChI | InChI=1S/C16H17BO2/c18-17-16-12-14(8-9-15(16)10-11-19-17)7-6-13-4-2-1-3-5-13/h1-5,8-9,12,18H,6-7,10-11H2 |
| InChIKey | JDGGETNLOINXGD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine?
The IUPAC name of 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine (CID 159150866) is 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine.
What is the SMILES notation for 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine?
The canonical SMILES for 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine is OB1OCCc2ccc(CCc3ccccc3)cc21.
What is the InChIKey of 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine?
The InChIKey is JDGGETNLOINXGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BO2/c18-17-16-12-14(8-9-15(16)10-11-19-17)7-6-13-4-2-1-3-5-13/h1-5,8-9,12,18H,6-7,10-11H2.
What are the key properties of 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine?
1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine has a molecular weight of 252.12 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-7-(2-phenylethyl)-3,4-dihydro-2,1-benzoxaborinine is sourced from PubChem (CID 159150866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).