C24H27B2N3O9 — CID 172528956
3-[[(2S)-2,3-bis[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carbonyl)amino]propanoyl]amino]propanoic acid (PubChem CID 172528956) has the molecular formula C24H27B2N3O9 and a molecular weight of 523.12 g/mol. Its IUPAC name is 3-[[(2S)-2,3-bis[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carbonyl)amino]propanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2,3-bis[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carbonyl)amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 172528956 |
| Molecular Formula | C24H27B2N3O9 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 3-[[(2S)-2,3-bis[(1-hydroxy-3,4-dihydro-2,1-benzoxaborinine-7-carbonyl)amino]propanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)[C@H](CNC(=O)c1ccc2c(c1)B(O)OCC2)NC(=O)c1ccc2c(c1)B(O)OCC2 |
| InChI | InChI=1S/C24H27B2N3O9/c30-21(31)5-8-27-24(34)20(29-23(33)17-4-2-15-7-10-38-26(36)19(15)12-17)13-28-22(32)16-3-1-14-6-9-37-25(35)18(14)11-16/h1-4,11-12,20,35-36H,5-10,13H2,(H,27,34)(H,28,32)(H,29,33)(H,30,31)/t20-/m0/s1 |
| InChIKey | XUTABDABXAGKSZ-FQEVSTJZSA-N |
| XLogP | -2.67 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|