C26H29B2N3O11 — CID 174145990
3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]hexanedioic acid (PubChem CID 174145990) has the molecular formula C26H29B2N3O11 and a molecular weight of 581.15 g/mol. Its IUPAC name is 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]hexanedioic acid.
| Compound Name | 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 174145990 |
| Molecular Formula | C26H29B2N3O11 |
| Molecular Weight | 581.15 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]hexanedioic acid |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)NC(CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C26H29B2N3O11/c1-13(29-24(36)14-2-4-16-11-41-27(39)19(16)8-14)23(26(38)30-18(10-22(34)35)6-7-21(32)33)31-25(37)15-3-5-17-12-42-28(40)20(17)9-15/h2-5,8-9,13,18,23,39-40H,6-7,10-12H2,1H3,(H,29,36)(H,30,38)(H,31,37)(H,32,33)(H,34,35)/t13-,18?,23-/m0/s1 |
| InChIKey | SFWTVTXEAZPCKE-ZQGZUXPFSA-N |
| XLogP | -2.14 |
| TPSA | 220.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.15 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|