C27H27B2FN4O11 — CID 170523720
(2,5-dioxopyrrolidin-1-yl) 3-[[(2S,3S)-2-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]propanoate (PubChem CID 170523720) has the molecular formula C27H27B2FN4O11 and a molecular weight of 624.15 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[(2S,3S)-2-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[(2S,3S)-2-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 170523720 |
| Molecular Formula | C27H27B2FN4O11 |
| Molecular Weight | 624.15 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[(2S,3S)-2-[(4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1cc(F)c2c(c1)B(O)OC2)C(=O)NCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H27B2FN4O11/c1-13(32-25(38)14-2-3-15-11-43-28(41)18(15)8-14)24(27(40)31-7-6-23(37)45-34-21(35)4-5-22(34)36)33-26(39)16-9-19-17(20(30)10-16)12-44-29(19)42/h2-3,8-10,13,24,41-42H,4-7,11-12H2,1H3,(H,31,40)(H,32,38)(H,33,39)/t13-,24-/m0/s1 |
| InChIKey | OILRFTXRLTXWCD-RZFZLAGVSA-N |
| XLogP | -2.71 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.15 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|