C28H31B2N5O11 — CID 170523633
(2,5-dioxopyrrolidin-1-yl) (3R)-4-amino-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]butanoate (PubChem CID 170523633) has the molecular formula C28H31B2N5O11 and a molecular weight of 635.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (3R)-4-amino-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (3R)-4-amino-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 170523633 |
| Molecular Formula | C28H31B2N5O11 |
| Molecular Weight | 635.20 g/mol |
| Exact Mass | 635.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (3R)-4-amino-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]butanoate |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)N[C@@H](CN)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H31B2N5O11/c1-14(32-26(39)15-2-4-17-12-44-29(42)20(17)8-15)25(34-27(40)16-3-5-18-13-45-30(43)21(18)9-16)28(41)33-19(11-31)10-24(38)46-35-22(36)6-7-23(35)37/h2-5,8-9,14,19,25,42-43H,6-7,10-13,31H2,1H3,(H,32,39)(H,33,41)(H,34,40)/t14-,19+,25-/m0/s1 |
| InChIKey | GRTUHEXBYMYJJK-FSKGLPCWSA-N |
| XLogP | -3.52 |
| TPSA | 235.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.20 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|