C30H26B2F5N3O9 — CID 174151818
(3R)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid (PubChem CID 174151818) has the molecular formula C30H26B2F5N3O9 and a molecular weight of 689.16 g/mol. Its IUPAC name is (3R)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid.
| Compound Name | (3R)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 174151818 |
| Molecular Formula | C30H26B2F5N3O9 |
| Molecular Weight | 689.16 g/mol |
| Exact Mass | 689.18 |
| IUPAC Name | (3R)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)N[C@@H](CC(=O)O)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H26B2F5N3O9/c1-12(38-28(43)13-2-4-15-10-48-31(46)19(15)6-13)27(40-29(44)14-3-5-16-11-49-32(47)20(16)7-14)30(45)39-17(9-21(41)42)8-18-22(33)24(35)26(37)25(36)23(18)34/h2-7,12,17,27,46-47H,8-11H2,1H3,(H,38,43)(H,39,45)(H,40,44)(H,41,42)/t12-,17+,27-/m0/s1 |
| InChIKey | BJMKEFRUBKMHFZ-BTUIKYQVSA-N |
| XLogP | -0.06 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.16 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|