C28H28B2N4O9 — CID 174145946
3-[2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoylamino]-3-pyridin-3-ylpropanoic acid (PubChem CID 174145946) has the molecular formula C28H28B2N4O9 and a molecular weight of 586.18 g/mol. Its IUPAC name is 3-[2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoylamino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoylamino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 174145946 |
| Molecular Formula | C28H28B2N4O9 |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 3-[2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoylamino]-3-pyridin-3-ylpropanoic acid |
| SMILES | CC(NC(=O)c1ccc2c(c1)B(O)OC2)C(NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)NC(CC(=O)O)c1cccnc1 |
| InChI | InChI=1S/C28H28B2N4O9/c1-15(32-26(37)16-4-6-19-13-42-29(40)21(19)9-16)25(28(39)33-23(11-24(35)36)18-3-2-8-31-12-18)34-27(38)17-5-7-20-14-43-30(41)22(20)10-17/h2-10,12,15,23,25,40-41H,11,13-14H2,1H3,(H,32,37)(H,33,39)(H,34,38)(H,35,36) |
| InChIKey | IXZRAJFWOUBTIV-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 196.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|