C31H33B2N3O10 — CID 174146001
(3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(4-methoxyphenyl)butanoic acid (PubChem CID 174146001) has the molecular formula C31H33B2N3O10 and a molecular weight of 629.24 g/mol. Its IUPAC name is (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(4-methoxyphenyl)butanoic acid.
| Compound Name | (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(4-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 174146001 |
| Molecular Formula | C31H33B2N3O10 |
| Molecular Weight | 629.24 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-4-(4-methoxyphenyl)butanoic acid |
| SMILES | COc1ccc(C[C@@H](CC(=O)O)NC(=O)[C@@H](NC(=O)c2ccc3c(c2)B(O)OC3)[C@H](C)NC(=O)c2ccc3c(c2)B(O)OC3)cc1 |
| InChI | InChI=1S/C31H33B2N3O10/c1-17(34-29(39)19-5-7-21-15-45-32(42)25(21)12-19)28(36-30(40)20-6-8-22-16-46-33(43)26(22)13-20)31(41)35-23(14-27(37)38)11-18-3-9-24(44-2)10-4-18/h3-10,12-13,17,23,28,42-43H,11,14-16H2,1-2H3,(H,34,39)(H,35,41)(H,36,40)(H,37,38)/t17-,23-,28-/m0/s1 |
| InChIKey | PVKHAJADEOVSSV-IYRXFJASSA-N |
| XLogP | -0.75 |
| TPSA | 192.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|