C27H27B2N3O10 — CID 170597643
(3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-(furan-2-yl)propanoic acid (PubChem CID 170597643) has the molecular formula C27H27B2N3O10 and a molecular weight of 575.15 g/mol. Its IUPAC name is (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-(furan-2-yl)propanoic acid.
| Compound Name | (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 170597643 |
| Molecular Formula | C27H27B2N3O10 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | (3S)-3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-(furan-2-yl)propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)N[C@@H](CC(=O)O)c1ccco1 |
| InChI | InChI=1S/C27H27B2N3O10/c1-14(30-25(35)15-4-6-17-12-41-28(38)19(17)9-15)24(27(37)31-21(11-23(33)34)22-3-2-8-40-22)32-26(36)16-5-7-18-13-42-29(39)20(18)10-16/h2-10,14,21,24,38-39H,11-13H2,1H3,(H,30,35)(H,31,37)(H,32,36)(H,33,34)/t14-,21-,24-/m0/s1 |
| InChIKey | ITQVZUSNADSIBX-WVRMYWEISA-N |
| XLogP | -1.04 |
| TPSA | 196.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|