C30H28B2F3N3O9 — CID 174145981
3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 174145981) has the molecular formula C30H28B2F3N3O9 and a molecular weight of 653.18 g/mol. Its IUPAC name is 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 174145981 |
| Molecular Formula | C30H28B2F3N3O9 |
| Molecular Weight | 653.18 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | 3-[[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]amino]-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)NC(CC(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H28B2F3N3O9/c1-15(36-27(41)17-5-7-19-13-46-31(44)22(19)10-17)26(38-28(42)18-6-8-20-14-47-32(45)23(20)11-18)29(43)37-24(12-25(39)40)16-3-2-4-21(9-16)30(33,34)35/h2-11,15,24,26,44-45H,12-14H2,1H3,(H,36,41)(H,37,43)(H,38,42)(H,39,40)/t15-,24?,26-/m0/s1 |
| InChIKey | KQKKAKCPEVJDND-CBNLTYRUSA-N |
| XLogP | 0.39 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|