C18H18BNO6 — CID 145400097
methyl (2S)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 145400097) has the molecular formula C18H18BNO6 and a molecular weight of 355.16 g/mol. Its IUPAC name is methyl (2S)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 145400097 |
| Molecular Formula | C18H18BNO6 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl (2S)-2-[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C18H18BNO6/c1-25-18(23)16(8-11-2-6-14(21)7-3-11)20-17(22)12-4-5-13-10-26-19(24)15(13)9-12/h2-7,9,16,21,24H,8,10H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | MWQXWJGUXZEMIE-INIZCTEOSA-N |
| XLogP | 0.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|