C19H19NO6 — CID 108799703
methyl 3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]benzoate (PubChem CID 108799703) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl 3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 108799703 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl 3-[[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(Cc2ccc(O)cc2)C(=O)OC)c1 |
| InChI | InChI=1S/C19H19NO6/c1-25-18(23)14-5-3-4-13(11-14)17(22)20-16(19(24)26-2)10-12-6-8-15(21)9-7-12/h3-9,11,16,21H,10H2,1-2H3,(H,20,22) |
| InChIKey | AUEARZLNIJREGK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |