C12H17NO5 — CID 56777278
methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate (PubChem CID 56777278) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate.
| Compound Name | methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate |
|---|---|
| PubChem CID | 56777278 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O.O |
| InChI | InChI=1S/C12H15NO4.H2O/c1-8(14)13-11(12(16)17-2)7-9-3-5-10(15)6-4-9;/h3-6,11,15H,7H2,1-2H3,(H,13,14);1H2/t11-;/m0./s1 |
| InChIKey | PGFUTSKWMKEEKA-MERQFXBCSA-N |
| XLogP | -0.21 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |