C14H17NO5 — CID 11818302
methyl (2R)-2-acetamido-3-(4-acetyloxyphenyl)propanoate (PubChem CID 11818302) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-(4-acetyloxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-(4-acetyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 11818302 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl (2R)-2-acetamido-3-(4-acetyloxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(OC(C)=O)cc1)NC(C)=O |
| InChI | InChI=1S/C14H17NO5/c1-9(16)15-13(14(18)19-3)8-11-4-6-12(7-5-11)20-10(2)17/h4-7,13H,8H2,1-3H3,(H,15,16)/t13-/m1/s1 |
| InChIKey | PYEZWEVAGBOOFX-CYBMUJFWSA-N |
| XLogP | 0.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|