C16H28N2O3 — CID 91439308
ethane;methyl 2-acetamido-3-phenylpropanoate;N-methylmethanamine (PubChem CID 91439308) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethane;methyl 2-acetamido-3-phenylpropanoate;N-methylmethanamine.
| Compound Name | ethane;methyl 2-acetamido-3-phenylpropanoate;N-methylmethanamine |
|---|---|
| PubChem CID | 91439308 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | ethane;methyl 2-acetamido-3-phenylpropanoate;N-methylmethanamine |
| SMILES | CC.CNC.COC(=O)C(Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C12H15NO3.C2H7N.C2H6/c1-9(14)13-11(12(15)16-2)8-10-6-4-3-5-7-10;1-3-2;1-2/h3-7,11H,8H2,1-2H3,(H,13,14);3H,1-2H3;1-2H3 |
| InChIKey | GUZXHSOOTLNAJE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |