C18H30N2O4 — CID 91577350
N,N-dimethylacetamide;ethane;methyl 2-acetamido-3-phenylpropanoate (PubChem CID 91577350) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane;methyl 2-acetamido-3-phenylpropanoate.
| Compound Name | N,N-dimethylacetamide;ethane;methyl 2-acetamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 91577350 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N,N-dimethylacetamide;ethane;methyl 2-acetamido-3-phenylpropanoate |
| SMILES | CC.CC(=O)N(C)C.COC(=O)C(Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C12H15NO3.C4H9NO.C2H6/c1-9(14)13-11(12(15)16-2)8-10-6-4-3-5-7-10;1-4(6)5(2)3;1-2/h3-7,11H,8H2,1-2H3,(H,13,14);1-3H3;1-2H3 |
| InChIKey | BPXITLZSJLCDPW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |