C12H15NO5 — CID 57243303
methyl (2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 57243303) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 57243303 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl (2S)-2-acetamido-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(C)=O |
| InChI | InChI=1S/C12H15NO5/c1-7(14)13-9(12(17)18-2)5-8-3-4-10(15)11(16)6-8/h3-4,6,9,15-16H,5H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | COAGLKSEPCJRPJ-VIFPVBQESA-N |
| XLogP | 0.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|