C17H24N2O5 — CID 74316393
methyl 2-[(1-aminocyclohexanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 74316393) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 2-[(1-aminocyclohexanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl 2-[(1-aminocyclohexanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 74316393 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 2-[(1-aminocyclohexanecarbonyl)amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)NC(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C17H24N2O5/c1-24-15(22)12(9-11-5-6-13(20)14(21)10-11)19-16(23)17(18)7-3-2-4-8-17/h5-6,10,12,20-21H,2-4,7-9,18H2,1H3,(H,19,23) |
| InChIKey | ZBALJWCDCQCQRC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|