C14H21BN2O5 — CID 101226418
CID 101226418 (PubChem CID 101226418) has the molecular formula C14H21BN2O5 and a molecular weight of 308.14 g/mol.
| Compound Name | CID 101226418 |
|---|---|
| PubChem CID | 101226418 |
| Molecular Formula | C14H21BN2O5 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[B-][N+](C)(C)C |
| InChI | InChI=1S/C14H20BN2O5/c1-17(2,3)15-14(21)16-10(13(20)22-4)7-9-5-6-11(18)12(19)8-9/h5-6,8,10H,7H2,1-4H3,(H2-,16,18,19,21)/q-1/p+1/t10-/m0/s1 |
| InChIKey | BNQPKHRMDVJXEL-JTQLQIEISA-O |
| XLogP | 0.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|