C20H24N2O5 — CID 16719165
methyl (2S)-2-[[(2S,3R)-2-amino-3-phenylbutanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 16719165) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3R)-2-amino-3-phenylbutanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S,3R)-2-amino-3-phenylbutanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 16719165 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl (2S)-2-[[(2S,3R)-2-amino-3-phenylbutanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@@H](N)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O5/c1-12(14-6-4-3-5-7-14)18(21)19(25)22-15(20(26)27-2)10-13-8-9-16(23)17(24)11-13/h3-9,11-12,15,18,23-24H,10,21H2,1-2H3,(H,22,25)/t12-,15+,18+/m1/s1 |
| InChIKey | HUAKIQHWONPEDG-MRAWALMUSA-N |
| XLogP | 1.43 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|