C14H18N2O7 — CID 73350116
(3S)-3-amino-4-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 73350116) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 73350116 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H18N2O7/c1-23-14(22)9(16-13(21)8(15)6-12(19)20)4-7-2-3-10(17)11(18)5-7/h2-3,5,8-9,17-18H,4,6,15H2,1H3,(H,16,21)(H,19,20)/t8-,9-/m0/s1 |
| InChIKey | OBWHKAOFTVGJPR-IUCAKERBSA-N |
| XLogP | -0.90 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|