C18H25N3O7S2 — CID 25194669
methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 25194669) has the molecular formula C18H25N3O7S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 25194669 |
| Molecular Formula | C18H25N3O7S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | methyl (2S)-2-[[(2R)-2-[[(2S)-2-acetamido-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@H](CS)NC(=O)[C@@H](CS)NC(C)=O |
| InChI | InChI=1S/C18H25N3O7S2/c1-9(22)19-12(7-29)16(25)21-13(8-30)17(26)20-11(18(27)28-2)5-10-3-4-14(23)15(24)6-10/h3-4,6,11-13,23-24,29-30H,5,7-8H2,1-2H3,(H,19,22)(H,20,26)(H,21,25)/t11-,12+,13-/m0/s1 |
| InChIKey | PDMDSMVHKUBPNJ-XQQFMLRXSA-N |
| XLogP | -0.85 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|