C14H20N2O7S — CID 155167283
(2R)-2-acetamido-3-sulfanylpropanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 155167283) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2R)-2-acetamido-3-sulfanylpropanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 155167283 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4.C5H9NO3S/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;1-3(7)6-4(2-10)5(8)9/h1-2,4,6,11-12H,3,10H2,(H,13,14);4,10H,2H2,1H3,(H,6,7)(H,8,9)/t6-;4-/m00/s1 |
| InChIKey | ZICVSUNIUZYNKT-FPAZSGHZSA-N |
| XLogP | -0.44 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|