C18H22N2O7 — CID 87689118
(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2S)-2-(hydroxyamino)-3-phenylpropanoic acid (PubChem CID 87689118) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2S)-2-(hydroxyamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2S)-2-(hydroxyamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87689118 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2S)-2-(hydroxyamino)-3-phenylpropanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O.O=C(O)[C@H](Cc1ccccc1)NO |
| InChI | InChI=1S/C9H11NO4.C9H11NO3/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;11-9(12)8(10-13)6-7-4-2-1-3-5-7/h1-2,4,6,11-12H,3,10H2,(H,13,14);1-5,8,10,13H,6H2,(H,11,12)/t6-;8-/m00/s1 |
| InChIKey | RVQXICDGMITIBF-KDBLBPRBSA-N |
| XLogP | 0.71 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|