C9H17NO12P2 — CID 89154660
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;phosphoric acid (PubChem CID 89154660) has the molecular formula C9H17NO12P2 and a molecular weight of 393.18 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;phosphoric acid.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 89154660 |
| Molecular Formula | C9H17NO12P2 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;phosphoric acid |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C9H11NO4.2H3O4P/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;2*1-5(2,3)4/h1-2,4,6,11-12H,3,10H2,(H,13,14);2*(H3,1,2,3,4) |
| InChIKey | OQHUQMIDAUFYTJ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 259.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|