C15H25NO10 — CID 146627663
(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol (PubChem CID 146627663) has the molecular formula C15H25NO10 and a molecular weight of 379.36 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 146627663 |
| Molecular Formula | C15H25NO10 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H11NO4.C6H14O6/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;7-1-3(9)5(11)6(12)4(10)2-8/h1-2,4,6,11-12H,3,10H2,(H,13,14);3-12H,1-2H2/t6-;3-,4-,5-,6-/m01/s1 |
| InChIKey | QGKOEQAGJKZFTK-ZZXKILTBSA-N |
| XLogP | -3.53 |
| TPSA | 225.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|