C13H17NO6 — CID 175952352
(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-methylprop-2-enoic acid (PubChem CID 175952352) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-methylprop-2-enoic acid.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175952352 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO4.C4H6O2/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5;1-3(2)4(5)6/h1-2,4,6,11-12H,3,10H2,(H,13,14);1H2,2H3,(H,5,6)/t6-;/m0./s1 |
| InChIKey | CNFFUAVTVOLDMQ-RGMNGODLSA-N |
| XLogP | 0.70 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|