C19H25NO6 — CID 174617851
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;3-tert-butylbenzene-1,2-diol (PubChem CID 174617851) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;3-tert-butylbenzene-1,2-diol.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;3-tert-butylbenzene-1,2-diol |
|---|---|
| PubChem CID | 174617851 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;3-tert-butylbenzene-1,2-diol |
| SMILES | CC(C)(C)c1cccc(O)c1O.NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H14O2.C9H11NO4/c1-10(2,3)7-5-4-6-8(11)9(7)12;10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h4-6,11-12H,1-3H3;1-2,4,6,11-12H,3,10H2,(H,13,14) |
| InChIKey | VPFOXGQVUGPTNS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|