C25H29N3O4 — CID 67737535
(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;5,10-diethylphenazine (PubChem CID 67737535) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;5,10-diethylphenazine.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;5,10-diethylphenazine |
|---|---|
| PubChem CID | 67737535 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;5,10-diethylphenazine |
| SMILES | CCN1c2ccccc2N(CC)c2ccccc21.N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C16H18N2.C9H11NO4/c1-3-17-13-9-5-7-11-15(13)18(4-2)16-12-8-6-10-14(16)17;10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h5-12H,3-4H2,1-2H3;1-2,4,6,11-12H,3,10H2,(H,13,14)/t;6-/m.0/s1 |
| InChIKey | NRSURQMFJUVTGO-ZCMDIHMWSA-N |
| XLogP | 4.37 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|