C9H13ClN2O3 — CID 70213265
(2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoic acid;hydrochloride (PubChem CID 70213265) has the molecular formula C9H13ClN2O3 and a molecular weight of 232.67 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70213265 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoic acid;hydrochloride |
| SMILES | Cl.Nc1cc(C[C@H](N)C(=O)O)ccc1O |
| InChI | InChI=1S/C9H12N2O3.ClH/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14;/h1-3,7,12H,4,10-11H2,(H,13,14);1H/t7-;/m0./s1 |
| InChIKey | LCUTUZRATMOQPT-FJXQXJEOSA-N |
| XLogP | 0.35 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|