C9H13N3O3 — CID 57367824
2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid (PubChem CID 57367824) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 57367824 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-amino-3-(3,5-diamino-4-hydroxyphenyl)propanoic acid |
| SMILES | Nc1cc(CC(N)C(=O)O)cc(N)c1O |
| InChI | InChI=1S/C9H13N3O3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,10-12H2,(H,14,15) |
| InChIKey | VPNHZIPMNHLIRB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|