C9H10F2N2O2 — CID 117115180
2-amino-3-(3-amino-4,5-difluorophenyl)propanoic acid (PubChem CID 117115180) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-amino-3-(3-amino-4,5-difluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-amino-4,5-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 117115180 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-amino-3-(3-amino-4,5-difluorophenyl)propanoic acid |
| SMILES | Nc1cc(CC(N)C(=O)O)cc(F)c1F |
| InChI | InChI=1S/C9H10F2N2O2/c10-5-1-4(2-6(12)8(5)11)3-7(13)9(14)15/h1-2,7H,3,12-13H2,(H,14,15) |
| InChIKey | DBXPGSUBBSNOAY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|