C9H9ClFNO2 — CID 11053116
2-amino-3-(4-chloro-3-fluorophenyl)propanoic acid (PubChem CID 11053116) has the molecular formula C9H9ClFNO2 and a molecular weight of 217.63 g/mol. Its IUPAC name is 2-amino-3-(4-chloro-3-fluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-chloro-3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 11053116 |
| Molecular Formula | C9H9ClFNO2 |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 2-amino-3-(4-chloro-3-fluorophenyl)propanoic acid |
| SMILES | NC(Cc1ccc(Cl)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H9ClFNO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| InChIKey | GARTVDUTCAAMSC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |