C12H14ClFO — CID 107882807
3-[(4-chloro-3-fluorophenyl)methyl]pentan-2-one (PubChem CID 107882807) has the molecular formula C12H14ClFO and a molecular weight of 228.69 g/mol. Its IUPAC name is 3-[(4-chloro-3-fluorophenyl)methyl]pentan-2-one.
| Compound Name | 3-[(4-chloro-3-fluorophenyl)methyl]pentan-2-one |
|---|---|
| PubChem CID | 107882807 |
| Molecular Formula | C12H14ClFO |
| Molecular Weight | 228.69 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-[(4-chloro-3-fluorophenyl)methyl]pentan-2-one |
| SMILES | CCC(Cc1ccc(Cl)c(F)c1)C(C)=O |
| InChI | InChI=1S/C12H14ClFO/c1-3-10(8(2)15)6-9-4-5-11(13)12(14)7-9/h4-5,7,10H,3,6H2,1-2H3 |
| InChIKey | BTAYWCGSAPTXJU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.69 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |