C11H14FNO4S2 — CID 117492329
2-amino-3-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)propanoic acid (PubChem CID 117492329) has the molecular formula C11H14FNO4S2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-amino-3-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117492329 |
| Molecular Formula | C11H14FNO4S2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-amino-3-(3-fluoro-4-methylsulfanyl-5-methylsulfonylphenyl)propanoic acid |
| SMILES | CSc1c(F)cc(CC(N)C(=O)O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C11H14FNO4S2/c1-18-10-7(12)3-6(4-8(13)11(14)15)5-9(10)19(2,16)17/h3,5,8H,4,13H2,1-2H3,(H,14,15) |
| InChIKey | PQVYWFOMTBTYFE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |