C11H12F2O4S — CID 117445810
3-(3,5-difluoro-4-methylsulfonylphenyl)-2-methylpropanoic acid (PubChem CID 117445810) has the molecular formula C11H12F2O4S and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-methylsulfonylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(3,5-difluoro-4-methylsulfonylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117445810 |
| Molecular Formula | C11H12F2O4S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-(3,5-difluoro-4-methylsulfonylphenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cc(F)c(S(C)(=O)=O)c(F)c1)C(=O)O |
| InChI | InChI=1S/C11H12F2O4S/c1-6(11(14)15)3-7-4-8(12)10(9(13)5-7)18(2,16)17/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | YSCCBXGPZQURAN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |