C16H14F2O2 — CID 117442171
3-(3,4-difluoro-5-phenylphenyl)-2-methylpropanoic acid (PubChem CID 117442171) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 3-(3,4-difluoro-5-phenylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(3,4-difluoro-5-phenylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117442171 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-(3,4-difluoro-5-phenylphenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cc(F)c(F)c(-c2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C16H14F2O2/c1-10(16(19)20)7-11-8-13(15(18)14(17)9-11)12-5-3-2-4-6-12/h2-6,8-10H,7H2,1H3,(H,19,20) |
| InChIKey | PGWDCMMQHOTZNL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |